C20H22Cl2N2O — CID 45007673
1-[(2-chlorophenyl)methyl]-N-[(4-chlorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 45007673) has the molecular formula C20H22Cl2N2O and a molecular weight of 377.31 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[(4-chlorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[(4-chlorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45007673 |
| Molecular Formula | C20H22Cl2N2O |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[(4-chlorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)C1CCN(Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H22Cl2N2O/c21-18-7-5-15(6-8-18)13-23-20(25)16-9-11-24(12-10-16)14-17-3-1-2-4-19(17)22/h1-8,16H,9-14H2,(H,23,25) |
| InChIKey | URDPFURIQHVPSK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |