C20H21ClF2N2O — CID 99827159
1-[(4-chloro-2-fluorophenyl)methyl]-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 99827159) has the molecular formula C20H21ClF2N2O and a molecular weight of 378.85 g/mol. Its IUPAC name is 1-[(4-chloro-2-fluorophenyl)methyl]-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-chloro-2-fluorophenyl)methyl]-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 99827159 |
| Molecular Formula | C20H21ClF2N2O |
| Molecular Weight | 378.85 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 1-[(4-chloro-2-fluorophenyl)methyl]-N-[(4-fluorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)C1CCN(Cc2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C20H21ClF2N2O/c21-17-4-3-16(19(23)11-17)13-25-9-7-15(8-10-25)20(26)24-12-14-1-5-18(22)6-2-14/h1-6,11,15H,7-10,12-13H2,(H,24,26) |
| InChIKey | DPSANSQLCZXYRN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.85 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |