C19H21ClFN3O — CID 100684761
1-[(4-chloro-2-fluorophenyl)methyl]-N-(pyridin-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 100684761) has the molecular formula C19H21ClFN3O and a molecular weight of 361.85 g/mol. Its IUPAC name is 1-[(4-chloro-2-fluorophenyl)methyl]-N-(pyridin-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-[(4-chloro-2-fluorophenyl)methyl]-N-(pyridin-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100684761 |
| Molecular Formula | C19H21ClFN3O |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-[(4-chloro-2-fluorophenyl)methyl]-N-(pyridin-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccccn1)C1CCN(Cc2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C19H21ClFN3O/c20-16-5-4-15(18(21)11-16)13-24-9-6-14(7-10-24)19(25)23-12-17-3-1-2-8-22-17/h1-5,8,11,14H,6-7,9-10,12-13H2,(H,23,25) |
| InChIKey | NZBPQYCSYYZRBX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |