C21H27N3O3 — CID 3316052
1-[(3-ethoxy-2-hydroxyphenyl)methyl]-N-(pyridin-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 3316052) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-[(3-ethoxy-2-hydroxyphenyl)methyl]-N-(pyridin-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-[(3-ethoxy-2-hydroxyphenyl)methyl]-N-(pyridin-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3316052 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 1-[(3-ethoxy-2-hydroxyphenyl)methyl]-N-(pyridin-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | CCOc1cccc(CN2CCC(C(=O)NCc3ccccn3)CC2)c1O |
| InChI | InChI=1S/C21H27N3O3/c1-2-27-19-8-5-6-17(20(19)25)15-24-12-9-16(10-13-24)21(26)23-14-18-7-3-4-11-22-18/h3-8,11,16,25H,2,9-10,12-15H2,1H3,(H,23,26) |
| InChIKey | JQVCBBVZICWPSB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|