C22H25Cl3N2O — CID 46773378
N-[3-(4-chlorophenyl)propyl]-1-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 46773378) has the molecular formula C22H25Cl3N2O and a molecular weight of 439.81 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)propyl]-1-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(4-chlorophenyl)propyl]-1-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46773378 |
| Molecular Formula | C22H25Cl3N2O |
| Molecular Weight | 439.81 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | N-[3-(4-chlorophenyl)propyl]-1-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCCc1ccc(Cl)cc1)C1CCN(Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C22H25Cl3N2O/c23-19-6-3-16(4-7-19)2-1-11-26-22(28)17-9-12-27(13-10-17)15-18-5-8-20(24)14-21(18)25/h3-8,14,17H,1-2,9-13,15H2,(H,26,28) |
| InChIKey | IQSRELWJTARSQJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.81 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|