C22H33Cl2N3O5 — CID 163328469
1-[(3,4-dichlorophenyl)methyl]-N-[3-(dimethylamino)-2,2-dimethylpropyl]piperidine-4-carboxamide;oxalic acid (PubChem CID 163328469) has the molecular formula C22H33Cl2N3O5 and a molecular weight of 490.43 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-N-[3-(dimethylamino)-2,2-dimethylpropyl]piperidine-4-carboxamide;oxalic acid.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-N-[3-(dimethylamino)-2,2-dimethylpropyl]piperidine-4-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 163328469 |
| Molecular Formula | C22H33Cl2N3O5 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-N-[3-(dimethylamino)-2,2-dimethylpropyl]piperidine-4-carboxamide;oxalic acid |
| SMILES | CN(C)CC(C)(C)CNC(=O)C1CCN(Cc2ccc(Cl)c(Cl)c2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H31Cl2N3O.C2H2O4/c1-20(2,14-24(3)4)13-23-19(26)16-7-9-25(10-8-16)12-15-5-6-17(21)18(22)11-15;3-1(4)2(5)6/h5-6,11,16H,7-10,12-14H2,1-4H3,(H,23,26);(H,3,4)(H,5,6) |
| InChIKey | APAAPZIRMFVHSE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|