C24H39N3O5 — CID 23724208
N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-(3-phenylpropyl)piperidine-4-carboxamide;oxalic acid (PubChem CID 23724208) has the molecular formula C24H39N3O5 and a molecular weight of 449.59 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-(3-phenylpropyl)piperidine-4-carboxamide;oxalic acid.
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-(3-phenylpropyl)piperidine-4-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 23724208 |
| Molecular Formula | C24H39N3O5 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-1-(3-phenylpropyl)piperidine-4-carboxamide;oxalic acid |
| SMILES | CN(C)CC(C)(C)CNC(=O)C1CCN(CCCc2ccccc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H37N3O.C2H2O4/c1-22(2,18-24(3)4)17-23-21(26)20-12-15-25(16-13-20)14-8-11-19-9-6-5-7-10-19;3-1(4)2(5)6/h5-7,9-10,20H,8,11-18H2,1-4H3,(H,23,26);(H,3,4)(H,5,6) |
| InChIKey | ZEKMOQAJYSOOTF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|