C18H26Cl2N2O — CID 53284678
1-[(3,4-dichlorophenyl)methyl]-N-pentan-3-ylpiperidine-4-carboxamide (PubChem CID 53284678) has the molecular formula C18H26Cl2N2O and a molecular weight of 357.33 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-N-pentan-3-ylpiperidine-4-carboxamide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-N-pentan-3-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 53284678 |
| Molecular Formula | C18H26Cl2N2O |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-N-pentan-3-ylpiperidine-4-carboxamide |
| SMILES | CCC(CC)NC(=O)C1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H26Cl2N2O/c1-3-15(4-2)21-18(23)14-7-9-22(10-8-14)12-13-5-6-16(19)17(20)11-13/h5-6,11,14-15H,3-4,7-10,12H2,1-2H3,(H,21,23) |
| InChIKey | XKJVWBAXWDMLPM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |