C21H23Cl2N3O2 — CID 1485113
1-[(3,4-dichlorophenyl)methyl]-N'-(4-methylbenzoyl)piperidine-4-carbohydrazide (PubChem CID 1485113) has the molecular formula C21H23Cl2N3O2 and a molecular weight of 420.34 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-N'-(4-methylbenzoyl)piperidine-4-carbohydrazide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-N'-(4-methylbenzoyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 1485113 |
| Molecular Formula | C21H23Cl2N3O2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-N'-(4-methylbenzoyl)piperidine-4-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)C2CCN(Cc3ccc(Cl)c(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C21H23Cl2N3O2/c1-14-2-5-16(6-3-14)20(27)24-25-21(28)17-8-10-26(11-9-17)13-15-4-7-18(22)19(23)12-15/h2-7,12,17H,8-11,13H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | LOZVONILXXKVGU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|