C19H28ClFN2OS — CID 53284596
N-(2-tert-butylsulfanylethyl)-1-[(2-chloro-6-fluorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 53284596) has the molecular formula C19H28ClFN2OS and a molecular weight of 386.96 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-1-[(2-chloro-6-fluorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-1-[(2-chloro-6-fluorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53284596 |
| Molecular Formula | C19H28ClFN2OS |
| Molecular Weight | 386.96 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-1-[(2-chloro-6-fluorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | CC(C)(C)SCCNC(=O)C1CCN(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C19H28ClFN2OS/c1-19(2,3)25-12-9-22-18(24)14-7-10-23(11-8-14)13-15-16(20)5-4-6-17(15)21/h4-6,14H,7-13H2,1-3H3,(H,22,24) |
| InChIKey | BSFXXUAYWIEZSR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.96 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|