C22H27ClFN3O — CID 53284587
1-[(2-chloro-6-fluorophenyl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxamide (PubChem CID 53284587) has the molecular formula C22H27ClFN3O and a molecular weight of 403.93 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53284587 |
| Molecular Formula | C22H27ClFN3O |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)C2CCN(Cc3c(F)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C22H27ClFN3O/c1-26(2)18-8-6-16(7-9-18)14-25-22(28)17-10-12-27(13-11-17)15-19-20(23)4-3-5-21(19)24/h3-9,17H,10-15H2,1-2H3,(H,25,28) |
| InChIKey | BZENEPDNJRNQIK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|