C25H31ClN4O — CID 53117838
1-[(5-chloro-1-methylindol-3-yl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxamide (PubChem CID 53117838) has the molecular formula C25H31ClN4O and a molecular weight of 439.00 g/mol. Its IUPAC name is 1-[(5-chloro-1-methylindol-3-yl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(5-chloro-1-methylindol-3-yl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53117838 |
| Molecular Formula | C25H31ClN4O |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 1-[(5-chloro-1-methylindol-3-yl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]piperidine-4-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)C2CCN(Cc3cn(C)c4ccc(Cl)cc34)CC2)cc1 |
| InChI | InChI=1S/C25H31ClN4O/c1-28(2)22-7-4-18(5-8-22)15-27-25(31)19-10-12-30(13-11-19)17-20-16-29(3)24-9-6-21(26)14-23(20)24/h4-9,14,16,19H,10-13,15,17H2,1-3H3,(H,27,31) |
| InChIKey | QXIILDYQMDMTMC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|