C32H38N4O — CID 50807745
N-[[4-(dimethylamino)phenyl]methyl]-1-[[1-[(3-methylphenyl)methyl]indol-2-yl]methyl]piperidine-4-carboxamide (PubChem CID 50807745) has the molecular formula C32H38N4O and a molecular weight of 494.68 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-1-[[1-[(3-methylphenyl)methyl]indol-2-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-1-[[1-[(3-methylphenyl)methyl]indol-2-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50807745 |
| Molecular Formula | C32H38N4O |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-1-[[1-[(3-methylphenyl)methyl]indol-2-yl]methyl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(Cn2c(CN3CCC(C(=O)NCc4ccc(N(C)C)cc4)CC3)cc3ccccc32)c1 |
| InChI | InChI=1S/C32H38N4O/c1-24-7-6-8-26(19-24)22-36-30(20-28-9-4-5-10-31(28)36)23-35-17-15-27(16-18-35)32(37)33-21-25-11-13-29(14-12-25)34(2)3/h4-14,19-20,27H,15-18,21-23H2,1-3H3,(H,33,37) |
| InChIKey | QWAPZQXLENHASL-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|