C31H42N4O — CID 50807695
1-[[1-[(3-methylphenyl)methyl]indol-2-yl]methyl]-N-(3-piperidin-1-ylpropyl)piperidine-4-carboxamide (PubChem CID 50807695) has the molecular formula C31H42N4O and a molecular weight of 486.70 g/mol. Its IUPAC name is 1-[[1-[(3-methylphenyl)methyl]indol-2-yl]methyl]-N-(3-piperidin-1-ylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-[[1-[(3-methylphenyl)methyl]indol-2-yl]methyl]-N-(3-piperidin-1-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50807695 |
| Molecular Formula | C31H42N4O |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | 1-[[1-[(3-methylphenyl)methyl]indol-2-yl]methyl]-N-(3-piperidin-1-ylpropyl)piperidine-4-carboxamide |
| SMILES | Cc1cccc(Cn2c(CN3CCC(C(=O)NCCCN4CCCCC4)CC3)cc3ccccc32)c1 |
| InChI | InChI=1S/C31H42N4O/c1-25-9-7-10-26(21-25)23-35-29(22-28-11-3-4-12-30(28)35)24-34-19-13-27(14-20-34)31(36)32-15-8-18-33-16-5-2-6-17-33/h3-4,7,9-12,21-22,27H,2,5-6,8,13-20,23-24H2,1H3,(H,32,36) |
| InChIKey | WJPACQRMFKTIPR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|