C25H31Cl2N3O6S2 — CID 133240639
1-[(2,6-dichlorophenyl)methylsulfonyl]-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]piperidine-3-carboxamide (PubChem CID 133240639) has the molecular formula C25H31Cl2N3O6S2 and a molecular weight of 604.58 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methylsulfonyl]-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-[(2,6-dichlorophenyl)methylsulfonyl]-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133240639 |
| Molecular Formula | C25H31Cl2N3O6S2 |
| Molecular Weight | 604.58 g/mol |
| Exact Mass | 603.10 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methylsulfonyl]-N-[2-(4-pyrrolidin-1-ylsulfonylphenoxy)ethyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCOc1ccc(S(=O)(=O)N2CCCC2)cc1)C1CCCN(S(=O)(=O)Cc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C25H31Cl2N3O6S2/c26-23-6-3-7-24(27)22(23)18-37(32,33)30-15-4-5-19(17-30)25(31)28-12-16-36-20-8-10-21(11-9-20)38(34,35)29-13-1-2-14-29/h3,6-11,19H,1-2,4-5,12-18H2,(H,28,31) |
| InChIKey | HQZNBUWAHFCPNZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|