C20H24Cl2N2O2S — CID 43922708
1-[(2,6-dichlorophenyl)methyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide (PubChem CID 43922708) has the molecular formula C20H24Cl2N2O2S and a molecular weight of 427.40 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43922708 |
| Molecular Formula | C20H24Cl2N2O2S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCSCc1ccco1)C1CCCN(Cc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C20H24Cl2N2O2S/c21-18-6-1-7-19(22)17(18)13-24-9-2-4-15(12-24)20(25)23-8-11-27-14-16-5-3-10-26-16/h1,3,5-7,10,15H,2,4,8-9,11-14H2,(H,23,25) |
| InChIKey | FDTJZTFTWTXKEO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|