C23H29ClN2O5S — CID 133189543
1-(4-chlorophenyl)sulfonyl-N-[3-(3,4-dimethoxyphenyl)propyl]piperidine-3-carboxamide (PubChem CID 133189543) has the molecular formula C23H29ClN2O5S and a molecular weight of 481.01 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-[3-(3,4-dimethoxyphenyl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-[3-(3,4-dimethoxyphenyl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133189543 |
| Molecular Formula | C23H29ClN2O5S |
| Molecular Weight | 481.01 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-[3-(3,4-dimethoxyphenyl)propyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(CCCNC(=O)C2CCCN(S(=O)(=O)c3ccc(Cl)cc3)C2)cc1OC |
| InChI | InChI=1S/C23H29ClN2O5S/c1-30-21-12-7-17(15-22(21)31-2)5-3-13-25-23(27)18-6-4-14-26(16-18)32(28,29)20-10-8-19(24)9-11-20/h7-12,15,18H,3-6,13-14,16H2,1-2H3,(H,25,27) |
| InChIKey | RAJFALVAOSHALE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.01 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|