C19H26ClF3N2O3 — CID 100625628
(3S)-1-[[4-(3-chloropropoxy)-3-methoxyphenyl]methyl]-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 100625628) has the molecular formula C19H26ClF3N2O3 and a molecular weight of 422.88 g/mol. Its IUPAC name is (3S)-1-[[4-(3-chloropropoxy)-3-methoxyphenyl]methyl]-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-[[4-(3-chloropropoxy)-3-methoxyphenyl]methyl]-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 100625628 |
| Molecular Formula | C19H26ClF3N2O3 |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (3S)-1-[[4-(3-chloropropoxy)-3-methoxyphenyl]methyl]-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | COc1cc(CN2CCC[C@H](C(=O)NCC(F)(F)F)C2)ccc1OCCCCl |
| InChI | InChI=1S/C19H26ClF3N2O3/c1-27-17-10-14(5-6-16(17)28-9-3-7-20)11-25-8-2-4-15(12-25)18(26)24-13-19(21,22)23/h5-6,10,15H,2-4,7-9,11-13H2,1H3,(H,24,26)/t15-/m0/s1 |
| InChIKey | GBRIFKWUGMNOFD-HNNXBMFYSA-N |
| XLogP | 3.59 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|