C20H26N2O5S — CID 46666885
4-[2-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]ethoxy]benzenesulfonamide (PubChem CID 46666885) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is 4-[2-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 46666885 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 4-[2-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]ethoxy]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(C2CCCN2CCOc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C20H26N2O5S/c1-25-16-7-10-20(26-2)18(14-16)19-4-3-11-22(19)12-13-27-15-5-8-17(9-6-15)28(21,23)24/h5-10,14,19H,3-4,11-13H2,1-2H3,(H2,21,23,24) |
| InChIKey | WYBNDNURPUUTAA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |