C16H26N2O4S — CID 94795561
N-[3-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]propyl]methanesulfonamide (PubChem CID 94795561) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is N-[3-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 94795561 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-[3-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]propyl]methanesulfonamide |
| SMILES | COc1ccc(OC)c([C@H]2CCCN2CCCNS(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H26N2O4S/c1-21-13-7-8-16(22-2)14(12-13)15-6-4-10-18(15)11-5-9-17-23(3,19)20/h7-8,12,15,17H,4-6,9-11H2,1-3H3/t15-/m1/s1 |
| InChIKey | BNNLQMBJPZVDHB-OAHLLOKOSA-N |
| XLogP | 1.78 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|