C16H25NO5S — CID 8834922
4-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]butane-1-sulfonic acid (PubChem CID 8834922) has the molecular formula C16H25NO5S and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 8834922 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 4-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]butane-1-sulfonic acid |
| SMILES | COc1ccc([C@@H]2CCCN2CCCCS(=O)(=O)O)c(OC)c1 |
| InChI | InChI=1S/C16H25NO5S/c1-21-13-7-8-14(16(12-13)22-2)15-6-5-10-17(15)9-3-4-11-23(18,19)20/h7-8,12,15H,3-6,9-11H2,1-2H3,(H,18,19,20)/t15-/m0/s1 |
| InChIKey | TYDCNFOQDAQHBD-HNNXBMFYSA-N |
| XLogP | 2.51 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|