C14H22N2O3S2 — CID 131960751
4-[2-(5-methyl-1,4-thiazepan-4-yl)ethoxy]benzenesulfonamide (PubChem CID 131960751) has the molecular formula C14H22N2O3S2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 4-[2-(5-methyl-1,4-thiazepan-4-yl)ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-(5-methyl-1,4-thiazepan-4-yl)ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 131960751 |
| Molecular Formula | C14H22N2O3S2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 4-[2-(5-methyl-1,4-thiazepan-4-yl)ethoxy]benzenesulfonamide |
| SMILES | CC1CCSCCN1CCOc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H22N2O3S2/c1-12-6-10-20-11-8-16(12)7-9-19-13-2-4-14(5-3-13)21(15,17)18/h2-5,12H,6-11H2,1H3,(H2,15,17,18) |
| InChIKey | QNJXDGJRPCQEKB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |