C15H24N2O4 — CID 114393408
[4-[(2,4,6-trimethoxyphenyl)methyl]morpholin-2-yl]methanamine (PubChem CID 114393408) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is [4-[(2,4,6-trimethoxyphenyl)methyl]morpholin-2-yl]methanamine.
| Compound Name | [4-[(2,4,6-trimethoxyphenyl)methyl]morpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 114393408 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | [4-[(2,4,6-trimethoxyphenyl)methyl]morpholin-2-yl]methanamine |
| SMILES | COc1cc(OC)c(CN2CCOC(CN)C2)c(OC)c1 |
| InChI | InChI=1S/C15H24N2O4/c1-18-11-6-14(19-2)13(15(7-11)20-3)10-17-4-5-21-12(8-16)9-17/h6-7,12H,4-5,8-10,16H2,1-3H3 |
| InChIKey | VKJOSEYYYYPRMI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |