C26H22ClNO3 — CID 178137051
8-[3-[3-(3-chlorophenyl)pyrrolidin-1-yl]propanoyl]benzo[g]chromen-4-one (PubChem CID 178137051) has the molecular formula C26H22ClNO3 and a molecular weight of 431.92 g/mol. Its IUPAC name is 8-[3-[3-(3-chlorophenyl)pyrrolidin-1-yl]propanoyl]benzo[g]chromen-4-one.
| Compound Name | 8-[3-[3-(3-chlorophenyl)pyrrolidin-1-yl]propanoyl]benzo[g]chromen-4-one |
|---|---|
| PubChem CID | 178137051 |
| Molecular Formula | C26H22ClNO3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 8-[3-[3-(3-chlorophenyl)pyrrolidin-1-yl]propanoyl]benzo[g]chromen-4-one |
| SMILES | O=C(CCN1CCC(c2cccc(Cl)c2)C1)c1ccc2cc3c(=O)ccoc3cc2c1 |
| InChI | InChI=1S/C26H22ClNO3/c27-22-3-1-2-17(13-22)20-6-9-28(16-20)10-7-24(29)19-5-4-18-14-23-25(30)8-11-31-26(23)15-21(18)12-19/h1-5,8,11-15,20H,6-7,9-10,16H2 |
| InChIKey | ACIMLCPQRPYYGJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|