C23H23NO3 — CID 178137357
6-[3-[3-(3-methylphenyl)pyrrolidin-1-yl]propanoyl]chromen-4-one (PubChem CID 178137357) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is 6-[3-[3-(3-methylphenyl)pyrrolidin-1-yl]propanoyl]chromen-4-one.
| Compound Name | 6-[3-[3-(3-methylphenyl)pyrrolidin-1-yl]propanoyl]chromen-4-one |
|---|---|
| PubChem CID | 178137357 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 6-[3-[3-(3-methylphenyl)pyrrolidin-1-yl]propanoyl]chromen-4-one |
| SMILES | Cc1cccc(C2CCN(CCC(=O)c3ccc4occc(=O)c4c3)C2)c1 |
| InChI | InChI=1S/C23H23NO3/c1-16-3-2-4-17(13-16)19-7-10-24(15-19)11-8-21(25)18-5-6-23-20(14-18)22(26)9-12-27-23/h2-6,9,12-14,19H,7-8,10-11,15H2,1H3 |
| InChIKey | NLBIJTUIUQEMFH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |