C17H21ClN2O2 — CID 146150629
1-[4-[3-(3-chlorophenyl)azetidine-1-carbonyl]piperidin-1-yl]ethanone (PubChem CID 146150629) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is 1-[4-[3-(3-chlorophenyl)azetidine-1-carbonyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[3-(3-chlorophenyl)azetidine-1-carbonyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 146150629 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[4-[3-(3-chlorophenyl)azetidine-1-carbonyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C(=O)N2CC(c3cccc(Cl)c3)C2)CC1 |
| InChI | InChI=1S/C17H21ClN2O2/c1-12(21)19-7-5-13(6-8-19)17(22)20-10-15(11-20)14-3-2-4-16(18)9-14/h2-4,9,13,15H,5-8,10-11H2,1H3 |
| InChIKey | ANAFRJHPPVUKFO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |