C18H23ClN2O2 — CID 97270431
1-[2-[(3S)-3-(3-chlorophenyl)pyrrolidin-1-yl]-2-oxoethyl]azepan-2-one (PubChem CID 97270431) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is 1-[2-[(3S)-3-(3-chlorophenyl)pyrrolidin-1-yl]-2-oxoethyl]azepan-2-one.
| Compound Name | 1-[2-[(3S)-3-(3-chlorophenyl)pyrrolidin-1-yl]-2-oxoethyl]azepan-2-one |
|---|---|
| PubChem CID | 97270431 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-[2-[(3S)-3-(3-chlorophenyl)pyrrolidin-1-yl]-2-oxoethyl]azepan-2-one |
| SMILES | O=C1CCCCCN1CC(=O)N1CC[C@@H](c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C18H23ClN2O2/c19-16-6-4-5-14(11-16)15-8-10-21(12-15)18(23)13-20-9-3-1-2-7-17(20)22/h4-6,11,15H,1-3,7-10,12-13H2/t15-/m1/s1 |
| InChIKey | DSDAYMNBKWXKHS-OAHLLOKOSA-N |
| XLogP | 3.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |