C22H24ClNO3 — CID 143161495
4-[3-(3-chlorophenyl)pyrrolidin-1-yl]-3-methyl-3-(4-methylphenyl)-4-oxobutanoic acid (PubChem CID 143161495) has the molecular formula C22H24ClNO3 and a molecular weight of 385.89 g/mol. Its IUPAC name is 4-[3-(3-chlorophenyl)pyrrolidin-1-yl]-3-methyl-3-(4-methylphenyl)-4-oxobutanoic acid.
| Compound Name | 4-[3-(3-chlorophenyl)pyrrolidin-1-yl]-3-methyl-3-(4-methylphenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 143161495 |
| Molecular Formula | C22H24ClNO3 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 4-[3-(3-chlorophenyl)pyrrolidin-1-yl]-3-methyl-3-(4-methylphenyl)-4-oxobutanoic acid |
| SMILES | Cc1ccc(C(C)(CC(=O)O)C(=O)N2CCC(c3cccc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C22H24ClNO3/c1-15-6-8-18(9-7-15)22(2,13-20(25)26)21(27)24-11-10-17(14-24)16-4-3-5-19(23)12-16/h3-9,12,17H,10-11,13-14H2,1-2H3,(H,25,26) |
| InChIKey | ZLYWDMIAZWDYAH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |