C25H24ClFN2O — CID 23108731
4-chloro-N-[[3-[1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]phenyl]methyl]benzamide (PubChem CID 23108731) has the molecular formula C25H24ClFN2O and a molecular weight of 422.93 g/mol. Its IUPAC name is 4-chloro-N-[[3-[1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]phenyl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[3-[1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 23108731 |
| Molecular Formula | C25H24ClFN2O |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 4-chloro-N-[[3-[1-[(4-fluorophenyl)methyl]pyrrolidin-3-yl]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(C2CCN(Cc3ccc(F)cc3)C2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H24ClFN2O/c26-23-8-6-20(7-9-23)25(30)28-15-19-2-1-3-21(14-19)22-12-13-29(17-22)16-18-4-10-24(27)11-5-18/h1-11,14,22H,12-13,15-17H2,(H,28,30) |
| InChIKey | GFFBCQCUTSLHOL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |