C25H25ClFN3O — CID 42858798
4-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 42858798) has the molecular formula C25H25ClFN3O and a molecular weight of 437.95 g/mol. Its IUPAC name is 4-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | 4-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 42858798 |
| Molecular Formula | C25H25ClFN3O |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 4-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc(CN2CCN(c3ccccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C25H25ClFN3O/c26-23-3-1-2-4-24(23)30-15-13-29(14-16-30)18-20-5-9-21(10-6-20)25(31)28-17-19-7-11-22(27)12-8-19/h1-12H,13-18H2,(H,28,31) |
| InChIKey | YZNDOGGCGXVDEC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |