C28H32N2OS — CID 23108747
N-[[3-[1-[(4-methylphenyl)methyl]piperidin-4-yl]phenyl]methyl]-4-methylsulfanylbenzamide (PubChem CID 23108747) has the molecular formula C28H32N2OS and a molecular weight of 444.64 g/mol. Its IUPAC name is N-[[3-[1-[(4-methylphenyl)methyl]piperidin-4-yl]phenyl]methyl]-4-methylsulfanylbenzamide.
| Compound Name | N-[[3-[1-[(4-methylphenyl)methyl]piperidin-4-yl]phenyl]methyl]-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 23108747 |
| Molecular Formula | C28H32N2OS |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[[3-[1-[(4-methylphenyl)methyl]piperidin-4-yl]phenyl]methyl]-4-methylsulfanylbenzamide |
| SMILES | CSc1ccc(C(=O)NCc2cccc(C3CCN(Cc4ccc(C)cc4)CC3)c2)cc1 |
| InChI | InChI=1S/C28H32N2OS/c1-21-6-8-22(9-7-21)20-30-16-14-24(15-17-30)26-5-3-4-23(18-26)19-29-28(31)25-10-12-27(32-2)13-11-25/h3-13,18,24H,14-17,19-20H2,1-2H3,(H,29,31) |
| InChIKey | DLOALVDJRLTXOC-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |