C24H32N2OS2 — CID 23108845
4-methylsulfanyl-N-[[3-[1-(3-methylsulfanylpropyl)piperidin-4-yl]phenyl]methyl]benzamide (PubChem CID 23108845) has the molecular formula C24H32N2OS2 and a molecular weight of 428.67 g/mol. Its IUPAC name is 4-methylsulfanyl-N-[[3-[1-(3-methylsulfanylpropyl)piperidin-4-yl]phenyl]methyl]benzamide.
| Compound Name | 4-methylsulfanyl-N-[[3-[1-(3-methylsulfanylpropyl)piperidin-4-yl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 23108845 |
| Molecular Formula | C24H32N2OS2 |
| Molecular Weight | 428.67 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 4-methylsulfanyl-N-[[3-[1-(3-methylsulfanylpropyl)piperidin-4-yl]phenyl]methyl]benzamide |
| SMILES | CSCCCN1CCC(c2cccc(CNC(=O)c3ccc(SC)cc3)c2)CC1 |
| InChI | InChI=1S/C24H32N2OS2/c1-28-16-4-13-26-14-11-20(12-15-26)22-6-3-5-19(17-22)18-25-24(27)21-7-9-23(29-2)10-8-21/h3,5-10,17,20H,4,11-16,18H2,1-2H3,(H,25,27) |
| InChIKey | BSIUKQDHKXKTEV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|