C32H32N4O2 — CID 143431944
4-amino-N-[[3-[3-[1-(4-aminobenzoyl)piperidin-4-yl]phenyl]phenyl]methyl]benzamide (PubChem CID 143431944) has the molecular formula C32H32N4O2 and a molecular weight of 504.63 g/mol. Its IUPAC name is 4-amino-N-[[3-[3-[1-(4-aminobenzoyl)piperidin-4-yl]phenyl]phenyl]methyl]benzamide.
| Compound Name | 4-amino-N-[[3-[3-[1-(4-aminobenzoyl)piperidin-4-yl]phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 143431944 |
| Molecular Formula | C32H32N4O2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 4-amino-N-[[3-[3-[1-(4-aminobenzoyl)piperidin-4-yl]phenyl]phenyl]methyl]benzamide |
| SMILES | Nc1ccc(C(=O)NCc2cccc(-c3cccc(C4CCN(C(=O)c5ccc(N)cc5)CC4)c3)c2)cc1 |
| InChI | InChI=1S/C32H32N4O2/c33-29-11-7-24(8-12-29)31(37)35-21-22-3-1-4-26(19-22)28-6-2-5-27(20-28)23-15-17-36(18-16-23)32(38)25-9-13-30(34)14-10-25/h1-14,19-20,23H,15-18,21,33-34H2,(H,35,37) |
| InChIKey | SBTMIQPAFZEBFR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|