C21H26N2O3 — CID 163533823
(3,4-dihydroxyphenyl)-[4-[3-(ethylaminomethyl)phenyl]piperidin-1-yl]methanone (PubChem CID 163533823) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is (3,4-dihydroxyphenyl)-[4-[3-(ethylaminomethyl)phenyl]piperidin-1-yl]methanone.
| Compound Name | (3,4-dihydroxyphenyl)-[4-[3-(ethylaminomethyl)phenyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 163533823 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (3,4-dihydroxyphenyl)-[4-[3-(ethylaminomethyl)phenyl]piperidin-1-yl]methanone |
| SMILES | CCNCc1cccc(C2CCN(C(=O)c3ccc(O)c(O)c3)CC2)c1 |
| InChI | InChI=1S/C21H26N2O3/c1-2-22-14-15-4-3-5-17(12-15)16-8-10-23(11-9-16)21(26)18-6-7-19(24)20(25)13-18/h3-7,12-13,16,22,24-25H,2,8-11,14H2,1H3 |
| InChIKey | DVGGZGLQDDQIHQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|