C13H17NO3 — CID 103957455
(3,4-dihydroxyphenyl)-(3-ethylpyrrolidin-1-yl)methanone (PubChem CID 103957455) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is (3,4-dihydroxyphenyl)-(3-ethylpyrrolidin-1-yl)methanone.
| Compound Name | (3,4-dihydroxyphenyl)-(3-ethylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 103957455 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (3,4-dihydroxyphenyl)-(3-ethylpyrrolidin-1-yl)methanone |
| SMILES | CCC1CCN(C(=O)c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C13H17NO3/c1-2-9-5-6-14(8-9)13(17)10-3-4-11(15)12(16)7-10/h3-4,7,9,15-16H,2,5-6,8H2,1H3 |
| InChIKey | GOKVJAPLAIGXHX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|