C13H15BrFNO — CID 112697956
(4-bromo-3-fluorophenyl)-(3-ethylpyrrolidin-1-yl)methanone (PubChem CID 112697956) has the molecular formula C13H15BrFNO and a molecular weight of 300.17 g/mol. Its IUPAC name is (4-bromo-3-fluorophenyl)-(3-ethylpyrrolidin-1-yl)methanone.
| Compound Name | (4-bromo-3-fluorophenyl)-(3-ethylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 112697956 |
| Molecular Formula | C13H15BrFNO |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | (4-bromo-3-fluorophenyl)-(3-ethylpyrrolidin-1-yl)methanone |
| SMILES | CCC1CCN(C(=O)c2ccc(Br)c(F)c2)C1 |
| InChI | InChI=1S/C13H15BrFNO/c1-2-9-5-6-16(8-9)13(17)10-3-4-11(14)12(15)7-10/h3-4,7,9H,2,5-6,8H2,1H3 |
| InChIKey | IHDHVRSJIIACPP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |