C12H11BrFNO — CID 162788159
3-azabicyclo[3.1.0]hexan-3-yl-(4-bromo-3-fluorophenyl)methanone (PubChem CID 162788159) has the molecular formula C12H11BrFNO and a molecular weight of 284.13 g/mol. Its IUPAC name is 3-azabicyclo[3.1.0]hexan-3-yl-(4-bromo-3-fluorophenyl)methanone.
| Compound Name | 3-azabicyclo[3.1.0]hexan-3-yl-(4-bromo-3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 162788159 |
| Molecular Formula | C12H11BrFNO |
| Molecular Weight | 284.13 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 3-azabicyclo[3.1.0]hexan-3-yl-(4-bromo-3-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(Br)c(F)c1)N1CC2CC2C1 |
| InChI | InChI=1S/C12H11BrFNO/c13-10-2-1-7(4-11(10)14)12(16)15-5-8-3-9(8)6-15/h1-2,4,8-9H,3,5-6H2 |
| InChIKey | ZSLSYZMBSJPSGU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.13 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |