C26H28N2O — CID 139986726
[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-(3-benzylphenyl)methanone (PubChem CID 139986726) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-(3-benzylphenyl)methanone.
| Compound Name | [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-(3-benzylphenyl)methanone |
|---|---|
| PubChem CID | 139986726 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-(3-benzylphenyl)methanone |
| SMILES | NCc1cccc(C2CCN(C(=O)c3cccc(Cc4ccccc4)c3)CC2)c1 |
| InChI | InChI=1S/C26H28N2O/c27-19-22-9-5-10-24(18-22)23-12-14-28(15-13-23)26(29)25-11-4-8-21(17-25)16-20-6-2-1-3-7-20/h1-11,17-18,23H,12-16,19,27H2 |
| InChIKey | LPESFQPAAXSJLG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |