C27H28N2O3 — CID 22266044
2-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]phenyl]-1-(4-hydroxyphenyl)ethanone (PubChem CID 22266044) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]phenyl]-1-(4-hydroxyphenyl)ethanone.
| Compound Name | 2-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]phenyl]-1-(4-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 22266044 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]phenyl]-1-(4-hydroxyphenyl)ethanone |
| SMILES | NCc1cccc(C2CCN(C(=O)c3cccc(CC(=O)c4ccc(O)cc4)c3)CC2)c1 |
| InChI | InChI=1S/C27H28N2O3/c28-18-20-4-2-5-23(16-20)21-11-13-29(14-12-21)27(32)24-6-1-3-19(15-24)17-26(31)22-7-9-25(30)10-8-22/h1-10,15-16,21,30H,11-14,17-18,28H2 |
| InChIKey | BOXBITJAYWJXPC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |