C24H28N4O3 — CID 67115231
1-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]phenyl]-3-(2-oxocyclobutyl)urea (PubChem CID 67115231) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 1-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]phenyl]-3-(2-oxocyclobutyl)urea.
| Compound Name | 1-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]phenyl]-3-(2-oxocyclobutyl)urea |
|---|---|
| PubChem CID | 67115231 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]phenyl]-3-(2-oxocyclobutyl)urea |
| SMILES | NCc1cccc(C2CCN(C(=O)c3cccc(NC(=O)NC4CCC4=O)c3)CC2)c1 |
| InChI | InChI=1S/C24H28N4O3/c25-15-16-3-1-4-18(13-16)17-9-11-28(12-10-17)23(30)19-5-2-6-20(14-19)26-24(31)27-21-7-8-22(21)29/h1-6,13-14,17,21H,7-12,15,25H2,(H2,26,27,31) |
| InChIKey | VBLCDEUJKJOOBI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |