C26H33N3O4 — CID 123649664
2-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]anilino]-1-[1-(hydroxymethoxy)cyclobutyl]ethanone (PubChem CID 123649664) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is 2-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]anilino]-1-[1-(hydroxymethoxy)cyclobutyl]ethanone.
| Compound Name | 2-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]anilino]-1-[1-(hydroxymethoxy)cyclobutyl]ethanone |
|---|---|
| PubChem CID | 123649664 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 2-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]anilino]-1-[1-(hydroxymethoxy)cyclobutyl]ethanone |
| SMILES | NCc1cccc(C2CCN(C(=O)c3cccc(NCC(=O)C4(OCO)CCC4)c3)CC2)c1 |
| InChI | InChI=1S/C26H33N3O4/c27-16-19-4-1-5-21(14-19)20-8-12-29(13-9-20)25(32)22-6-2-7-23(15-22)28-17-24(31)26(33-18-30)10-3-11-26/h1-2,4-7,14-15,20,28,30H,3,8-13,16-18,27H2 |
| InChIKey | JODXNQVZKHSVOA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|