C28H35N3O4 — CID 67115205
(1R,2R,4S,5S,6R)-N-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]phenyl]-5,6-dihydroxybicyclo[2.2.2]octane-2-carboxamide (PubChem CID 67115205) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is (1R,2R,4S,5S,6R)-N-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]phenyl]-5,6-dihydroxybicyclo[2.2.2]octane-2-carboxamide.
| Compound Name | (1R,2R,4S,5S,6R)-N-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]phenyl]-5,6-dihydroxybicyclo[2.2.2]octane-2-carboxamide |
|---|---|
| PubChem CID | 67115205 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | (1R,2R,4S,5S,6R)-N-[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]phenyl]-5,6-dihydroxybicyclo[2.2.2]octane-2-carboxamide |
| SMILES | NCc1cccc(C2CCN(C(=O)c3cccc(NC(=O)[C@@H]4C[C@@H]5CC[C@H]4[C@@H](O)[C@H]5O)c3)CC2)c1 |
| InChI | InChI=1S/C28H35N3O4/c29-16-17-3-1-4-19(13-17)18-9-11-31(12-10-18)28(35)21-5-2-6-22(14-21)30-27(34)24-15-20-7-8-23(24)26(33)25(20)32/h1-6,13-14,18,20,23-26,32-33H,7-12,15-16,29H2,(H,30,34)/t20-,23+,24+,25-,26+/m0/s1 |
| InChIKey | KNEPQRWTJNOYGP-AZXQFHINSA-N |
| XLogP | 2.87 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |