C23H25BN2O3 — CID 90206946
[7-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]naphthalen-1-yl]boronic acid (PubChem CID 90206946) has the molecular formula C23H25BN2O3 and a molecular weight of 388.28 g/mol. Its IUPAC name is [7-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]naphthalen-1-yl]boronic acid.
| Compound Name | [7-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]naphthalen-1-yl]boronic acid |
|---|---|
| PubChem CID | 90206946 |
| Molecular Formula | C23H25BN2O3 |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [7-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]naphthalen-1-yl]boronic acid |
| SMILES | NCc1cccc(C2CCN(C(=O)c3ccc4cccc(B(O)O)c4c3)CC2)c1 |
| InChI | InChI=1S/C23H25BN2O3/c25-15-16-3-1-5-19(13-16)17-9-11-26(12-10-17)23(27)20-8-7-18-4-2-6-22(24(28)29)21(18)14-20/h1-8,13-14,17,28-29H,9-12,15,25H2 |
| InChIKey | BDADFWVRNJIUJH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|