C27H32BN3O3 — CID 71005450
[2-[[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-N-methylanilino]methyl]phenyl]boronic acid (PubChem CID 71005450) has the molecular formula C27H32BN3O3 and a molecular weight of 457.38 g/mol. Its IUPAC name is [2-[[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-N-methylanilino]methyl]phenyl]boronic acid.
| Compound Name | [2-[[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-N-methylanilino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 71005450 |
| Molecular Formula | C27H32BN3O3 |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | [2-[[3-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-N-methylanilino]methyl]phenyl]boronic acid |
| SMILES | CN(Cc1ccccc1B(O)O)c1cccc(C(=O)N2CCC(c3cccc(CN)c3)CC2)c1 |
| InChI | InChI=1S/C27H32BN3O3/c1-30(19-24-7-2-3-11-26(24)28(33)34)25-10-5-9-23(17-25)27(32)31-14-12-21(13-15-31)22-8-4-6-20(16-22)18-29/h2-11,16-17,21,33-34H,12-15,18-19,29H2,1H3 |
| InChIKey | OPECVSRILHQOQI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|