C32H36BN3O5 — CID 89182506
[2-[[[3-[2-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-2-oxoethyl]-4-methyl-2-oxochromen-7-yl]-methylamino]methyl]phenyl]boronic acid (PubChem CID 89182506) has the molecular formula C32H36BN3O5 and a molecular weight of 553.47 g/mol. Its IUPAC name is [2-[[[3-[2-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-2-oxoethyl]-4-methyl-2-oxochromen-7-yl]-methylamino]methyl]phenyl]boronic acid.
| Compound Name | [2-[[[3-[2-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-2-oxoethyl]-4-methyl-2-oxochromen-7-yl]-methylamino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 89182506 |
| Molecular Formula | C32H36BN3O5 |
| Molecular Weight | 553.47 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | [2-[[[3-[2-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-2-oxoethyl]-4-methyl-2-oxochromen-7-yl]-methylamino]methyl]phenyl]boronic acid |
| SMILES | Cc1c(CC(=O)N2CCC(c3cccc(CN)c3)CC2)c(=O)oc2cc(N(C)Cc3ccccc3B(O)O)ccc12 |
| InChI | InChI=1S/C32H36BN3O5/c1-21-27-11-10-26(35(2)20-25-7-3-4-9-29(25)33(39)40)17-30(27)41-32(38)28(21)18-31(37)36-14-12-23(13-15-36)24-8-5-6-22(16-24)19-34/h3-11,16-17,23,39-40H,12-15,18-20,34H2,1-2H3 |
| InChIKey | CTGCCAYTKBRCRI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|