C23H30N2O — CID 23587223
1-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-5-phenylpentan-1-one (PubChem CID 23587223) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is 1-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-5-phenylpentan-1-one.
| Compound Name | 1-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 23587223 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 1-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-5-phenylpentan-1-one |
| SMILES | NCc1cccc(C2CCN(C(=O)CCCCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H30N2O/c24-18-20-10-6-11-22(17-20)21-13-15-25(16-14-21)23(26)12-5-4-9-19-7-2-1-3-8-19/h1-3,6-8,10-11,17,21H,4-5,9,12-16,18,24H2 |
| InChIKey | IVUPTHMLXRHVCI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|