C20H25BN2O3 — CID 67115113
[4-[2-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-2-oxoethyl]phenyl]boronic acid (PubChem CID 67115113) has the molecular formula C20H25BN2O3 and a molecular weight of 352.24 g/mol. Its IUPAC name is [4-[2-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-2-oxoethyl]phenyl]boronic acid.
| Compound Name | [4-[2-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-2-oxoethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 67115113 |
| Molecular Formula | C20H25BN2O3 |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | [4-[2-[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-2-oxoethyl]phenyl]boronic acid |
| SMILES | NCc1cccc(C2CCN(C(=O)Cc3ccc(B(O)O)cc3)CC2)c1 |
| InChI | InChI=1S/C20H25BN2O3/c22-14-16-2-1-3-18(12-16)17-8-10-23(11-9-17)20(24)13-15-4-6-19(7-5-15)21(25)26/h1-7,12,17,25-26H,8-11,13-14,22H2 |
| InChIKey | HWDJZITVCQQLIQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|