C22H24BN3O3 — CID 90206990
[2-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]quinolin-6-yl]boronic acid (PubChem CID 90206990) has the molecular formula C22H24BN3O3 and a molecular weight of 389.26 g/mol. Its IUPAC name is [2-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]quinolin-6-yl]boronic acid.
| Compound Name | [2-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]quinolin-6-yl]boronic acid |
|---|---|
| PubChem CID | 90206990 |
| Molecular Formula | C22H24BN3O3 |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | [2-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]quinolin-6-yl]boronic acid |
| SMILES | NCc1cccc(C2CCN(C(=O)c3ccc4cc(B(O)O)ccc4n3)CC2)c1 |
| InChI | InChI=1S/C22H24BN3O3/c24-14-15-2-1-3-17(12-15)16-8-10-26(11-9-16)22(27)21-6-4-18-13-19(23(28)29)5-7-20(18)25-21/h1-7,12-13,16,28-29H,8-11,14,24H2 |
| InChIKey | RHJAZQAZIVNHKX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|