C21H24BN3O3 — CID 67115206
[5-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-7H-indol-2-yl]boronic acid (PubChem CID 67115206) has the molecular formula C21H24BN3O3 and a molecular weight of 377.25 g/mol. Its IUPAC name is [5-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-7H-indol-2-yl]boronic acid.
| Compound Name | [5-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-7H-indol-2-yl]boronic acid |
|---|---|
| PubChem CID | 67115206 |
| Molecular Formula | C21H24BN3O3 |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | [5-[4-[3-(aminomethyl)phenyl]piperidine-1-carbonyl]-7H-indol-2-yl]boronic acid |
| SMILES | NCc1cccc(C2CCN(C(=O)C3=CCC4=NC(B(O)O)=CC4=C3)CC2)c1 |
| InChI | InChI=1S/C21H24BN3O3/c23-13-14-2-1-3-16(10-14)15-6-8-25(9-7-15)21(26)17-4-5-19-18(11-17)12-20(24-19)22(27)28/h1-4,10-12,15,27-28H,5-9,13,23H2 |
| InChIKey | XIFVDWZHFOMEJP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|