C25H30N2O2Si — CID 90213570
[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[7-[hydroxy(dimethyl)silyl]naphthalen-2-yl]methanone (PubChem CID 90213570) has the molecular formula C25H30N2O2Si and a molecular weight of 418.61 g/mol. Its IUPAC name is [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[7-[hydroxy(dimethyl)silyl]naphthalen-2-yl]methanone.
| Compound Name | [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[7-[hydroxy(dimethyl)silyl]naphthalen-2-yl]methanone |
|---|---|
| PubChem CID | 90213570 |
| Molecular Formula | C25H30N2O2Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[7-[hydroxy(dimethyl)silyl]naphthalen-2-yl]methanone |
| SMILES | C[Si](C)(O)c1ccc2ccc(C(=O)N3CCC(c4cccc(CN)c4)CC3)cc2c1 |
| InChI | InChI=1S/C25H30N2O2Si/c1-30(2,29)24-9-8-19-6-7-22(15-23(19)16-24)25(28)27-12-10-20(11-13-27)21-5-3-4-18(14-21)17-26/h3-9,14-16,20,29H,10-13,17,26H2,1-2H3 |
| InChIKey | JKHMYEHCXOKMFG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|